An aqueous solution contains dissolved \(\mathrm{C}_{6} \mathrm{H}_{5} \mathrm{NH}_{3} \mathrm{Cl}\) and \(\mathrm{C}_{6} \mathrm{H}_{5} \mathrm{NH}_{2}\). The concentration of \(\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{2}\) is \(0.50 \mathrm{M}\) and \(\mathrm{pH}\) is \(4.20\). a. Calculate the concentration of \(\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}\) in this buffer solution. b. Calculate the \(\mathrm{pH}\) after \(4.0 \mathrm{~g} \mathrm{NaOH}(s)\) is added to \(1.0 \mathrm{~L}\) of this solution. (Neglect any volume change.)

Short Answer

Expert verified
a. The concentration of $\mathrm{C}_{6} \mathrm{H}_{3}\mathrm{NH}_{3}^{+}$ in the buffer solution is \(0.91 M\). b. The new pH after adding \(4.0\:g\) of NaOH to the solution is \(4.11\).

Step by step solution

01

The Henderson-Hasselbalch equation is given by: \[pH = pK_a + \log \frac{[\mathrm{A}^-]}{[\mathrm{HA}]}\] In this case, \(\mathrm{HA} = \mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}\) and \(\mathrm{A}^- = \mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{2}\). #Step 2: Find the value of pKa#

The pKa value can be found using the given pH and concentration values: \[4.20 = pK_a + \log \frac{[\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{2}]}{[\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}]}\] We need to find [\(\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}\)], but first, we need deduce the \(pK_a\). #Step 3: Determine the pKb for C6H5NH2#
02

Since we are given the pH, we can determine the \(\mathrm{pOH}\) of the solution: \(pOH = 14.0 - pH\) \(pOH = 14.0 - 4.2\) \(pOH = 9.8\) Using the relationship \(pK_b = pOH - \log \frac{[\mathrm{BH}^+]}{[\mathrm{B}]}\), where in this case, \(\mathrm{B} = \mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{2}\) and \(\mathrm{BH}^+ = \mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}\), we can determine the \(pK_b\) for \(\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{2}\). \(pK_b = 9.8 - \log \frac{[\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}]}{[\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{2}]}\) #Step 4: Determine the pKa for C6H5NH2#

We can determine the pKa of \(\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{2}\) from pKb using the relationship: \[pK_a = 14.0 - pK_b\] Now we can substitute the derived value of \(pK_b\) back into the Henderson-Hasselbalch equation. #Step 5: Calculate the concentration of C6H3NH3+#
03

Now that we have the \(pK_a\) value, we can determine the concentration of \(\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}\) using the Henderson-Hasselbalch equation: \[4.2 = pK_a + \log \frac{[\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{2}]}{[\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}]}\] Solving for [\(\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}\)] will give us the concentration of the \(\mathrm{C}_{6} \mathrm{H}_{3} \mathrm{NH}_{3}^{+}\) in this buffer solution. #Step 6: Calculate the moles of NaOH added to the solution#

We are given that \(4.0 \mathrm{~g}\) of \(\mathrm{NaOH}\) is added to \(1.0 \mathrm{~L}\) of the solution. We need to calculate the moles of \(\mathrm{NaOH}\) in order to calculate the change in \(\mathrm{pH}\). The molar mass of \(\mathrm{NaOH}\) is \(40 \mathrm{~g/mol}\). To find the moles of \(\mathrm{NaOH}\) added: Moles = \(\frac{\mathrm{mass}}{\mathrm{molar~mass}}\) Moles of $\mathrm{NaOH} = \frac{4.0 \mathrm{~g}}{40 \mathrm{~g/mol}} = 0.1 \mathrm{~mol}\) #Step 7: Calculate the change in pOH due to added NaOH#
04

Since \(\mathrm{NaOH}\) is a strong base, we can assume the change in \(\mathrm{pOH}\) to be equal to the \(\mathrm{pOH}\) of the added \(\mathrm{NaOH}\): Change in pOH = \( -\log ([\mathrm{OH}^-])\) Change in pOH = \(-\log (\frac{0.1 \mathrm{~mol}}{1.0 \mathrm{~L}}) = -\log (0.1)\) #Step 8: Calculate the new pH after adding NaOH#

Now, we can calculate the new \(\mathrm{pH}\) by adding the change in \(\mathrm{pOH}\) to the original \(\mathrm{pH}\): New pH = Original pH - Change in pOH After calculating the new pH, we can determine the pH of the buffer solution after adding 4.0 g of NaOH.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Henderson-Hasselbalch equation
One of the most helpful tools in understanding buffer solutions is the Henderson-Hasselbalch equation. This formula provides a direct way to calculate the pH of a buffer solution based on the concentrations of the acid and its conjugate base. Formulated as \(pH = pK_a + \log \frac{[A^-]}{[HA]}\), it relates the pH of the solution to the pKa, which is the acid dissociation constant, and the ratio of the concentrations of the deprotonated species \(A^-\) and the protonated species \(HA\). A buffer works to maintain pH by resisting changes when small amounts of acid or base are added. Understanding this equation is crucial for predicting how the pH will change under different conditions, making it an essential concept for students studying acid-base chemistry.

Optimally, using the Henderson-Hasselbalch equation starts with knowing the acid dissociation constant (pKa) of the acid involved in the buffer system. In given problems, once pKa is determined or provided, students can plug in the concentrations of the acid and base to find the pH. As such, the equation bridges theoretical knowledge with practical application to buffer systems in laboratory and biological settings.
Acid-base equilibrium
The concept of acid-base equilibrium lies at the heart of understanding how buffer solutions work. An acid-base equilibrium occurs when a weak acid and its conjugate base (or a weak base and its conjugate acid) are present in a solution. In such a system, the acid can donate a proton (H+) to the base, and the base can accept a proton, with the reaction being reversible. This equilibrium is given by the following reaction: \(HA \rightleftharpoons H^+ + A^-\).

In solutions including a buffer, the acid-base equilibrium is important because it explains the buffer's ability to resist changes in pH. When a small amount of additional acid or base is introduced to the system, the equilibrium shifts to either absorb the added H+ ions or generate more of them, thus keeping the pH relatively stable. For educational content, it's vital to emphasize the dynamic nature of this equilibrium and how it allows buffers to function effectively within narrow pH ranges, which is particularly important in biological systems like blood.
pKa and pKb relationship
The relationship between pKa and pKb is fundamental to understanding the behavior of acid-base pairs. pKa and pKb are measures of the strength of an acid and a base, respectively. The pKa is derived from the acid dissociation constant (Ka), and pKb is derived from the base dissociation constant (Kb). These values indicate how easily an acid can lose a proton and how readily a base can accept a proton.

The relationship between the two is given by the equation \(pK_a + pK_b = 14\) in water at 25°C, which is derived from the ion product constant of water (Kw). This equation indicates that a strong acid (lower pKa) will have a weak conjugate base (higher pKb), and vice versa. It is important for students to grasp this concept to understand the balance between acids and bases in buffer solutions and how this balance affects pH levels upon the addition of strong acids or bases.
Calculating moles in chemistry
Calculating moles is a fundamental skill in chemistry that enables students to understand the quantitative aspects of chemical reactions and solutions. The mole allows chemists to count atoms, molecules, or other entities in a macroscopic amount of substance. The number of moles is calculated by dividing the mass of the sample by its molar mass, expressed in the formula \(\text{moles} = \frac{\text{mass}}{\text{molar mass}}\).

Understanding the mole concept allows students to relate the microscopic world of atoms and molecules to the macroscopic world we observe. It's essential for tasks like determining the amount of reactants needed or predicting the yield from a chemical reaction. When it comes to buffer solutions and titrations, knowing the number of moles of a strong acid or base added to a buffer is critical in predicting the resulting pH change. This practical application reinforces why moles are a cornerstone in chemistry education, as they help bridge the gap between theoretical understanding and observable chemical phenomena.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Derive an equation analogous to the Henderson-Hasselbalch equation but relating \(\mathrm{pOH}\) and \(\mathrm{p} K_{\mathrm{b}}\) of a buffered solution composed of a weak base and its conjugate acid, such as \(\mathrm{NH}_{3}\) and \(\mathrm{NH}_{4}^{+}\).

A \(10.00-g\) sample of the ionic compound \(\mathrm{NaA}\), where \(\mathrm{A}^{-}\) is the anion of a weak acid, was dissolved in enough water to make \(100.0 \mathrm{~mL}\) of solution and was then titrated with \(0.100 \mathrm{M} \mathrm{HCl}\). After \(500.0 \mathrm{~mL}\) HCl was added, the \(\mathrm{pH}\) was \(5.00\). The experimenter found that \(1.00 \mathrm{~L}\) of \(0.100 \mathrm{M} \mathrm{HCl}\) was required to reach the stoichiometric point of the titration. a. What is the molar mass of NaA? b. Calculate the \(\mathrm{pH}\) of the solution at the stoichiometric point of the titration.

Methyl red has the following structure: CN(C)c1ccc(N=Nc2ccccc2C(=O)O)cc1 It undergoes a color change from red to yellow as a solution gets more basic. Calculate an approximate \(\mathrm{pH}\) range for which methyl red is useful. What is the color change and the \(\mathrm{pH}\) at the color change when a weak acid is titrated with a strong base using methyl red as an indicator? What is the color change and the \(\mathrm{pH}\) at the color change when a weak base is titrated with a strong acid using methyl red as an indicator? For which of these two types of titrations is methyl red a possible indicator?

You have the following reagents on hand: \begin{tabular}{|ll|} \hline Solids \(\left(\mathrm{p} \boldsymbol{K}_{\mathrm{a}}\right.\) of Acid Form Is Given) & Solutions \\ \hline Benzoic acid (4.19) & \(5.0 \mathrm{M} \mathrm{HCl}\) \\ Sodium acetate (4.74) & \(1.0 \mathrm{M}\) acetic acid (4.74) \\ Potassium fluoride (3.14) & \(2.6 \mathrm{M} \mathrm{NaOH}\) \\ Ammonium chloride (9.26) & \(1.0 \mathrm{M} \mathrm{HOCl}(7.46)\) \\ \hline \end{tabular} What combinations of reagents would you use to prepare buffers at the following \(\mathrm{pH}\) values? a. \(3.0\) b. \(4.0\) c. \(5.0\) d. \(7.0\) e. \(9.0\)

Acid-base indicators mark the end point of titrations by "magically" turning a different color. Explain the "magic" behind acid-base indicators.

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.

Sign-up for free