Give the structural formula of two different dipeptides formed between arginine and serine.

Short Answer

Expert verified
Answer: The two dipeptide structural formulas are: 1. Arginine as N-terminal amino acid: NH2-CH(NH2-C(NH)-NH-)-CO-NH-CH(CH2-OH)-COOH 2. Serine as N-terminal amino acid: NH2-CH(CH2-OH)-CO-NH-CH(NH2-C(NH)-NH-)-COOH

Step by step solution

01

Understand the structure of arginine and serine

Before forming a dipeptide, it's essential to know the structure of the individual amino acids, arginine and serine. Arginine is a basic amino acid with the side chain formula: NH2-C(NH)-NH-. Serine is a polar, uncharged amino acid with the side chain formula: CH2-OH. The general structure of an amino acid is NH2-CHR-COOH, where R represents the side chain.
02

Form the peptide bond

A peptide bond is formed between the amino group (NH2) of one amino acid and the carboxyl group (COOH) of another amino acid through a condensation reaction (removal of water). This bond is -CO-NH-.
03

Create the dipeptide with arginine as N-terminal amino acid

When arginine serves as the N-terminal amino acid and serine as the C-terminal amino acid, the dipeptide is formed by linking their peptide bond. Remove the H from the amino group (NH2) of serine and the OH from the carboxyl group (COOH) of arginine: NH2-CHR(COOH) + HN-CHR(COOH) -> NH2-CHR(-CO-NH)-CHR(COOH) In this case, as arginine is the N-terminal amino acid, its structure will be: NH2-CH(Arginine side chain)-CO-NH-CH(Serine side chain)-COOH
04

Create the dipeptide with serine as N-terminal amino acid

Next, when serine serves as the N-terminal amino acid and arginine as the C-terminal amino acid, the dipeptide is formed in a similar fashion. Remove the H from the amino group (NH2) of arginine and the OH from the carboxyl group (COOH) of serine: NH2-CHR(COOH) + HN-CHR(COOH) -> NH2-CHR(-CO-NH)-CHR(COOH) In this case, as serine is the N-terminal amino acid, its structure will be: NH2-CH(Serine side chain)-CO-NH-CH(Arginine side chain)-COOH
05

Write the final structural formulas of both dipeptides

Substitute the side chains of arginine and serine in the two dipeptide combinations: 1. Arginine as N-terminal amino acid: NH2-CH(NH2-C(NH)-NH-)-CO-NH-CH(CH2-OH)-COOH 2. Serine as N-terminal amino acid: NH2-CH(CH2-OH)-CO-NH-CH(NH2-C(NH)-NH-)-COOH These represent the structural formulas of the two different dipeptides formed between arginine and serine.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Peptide Bond
The peptide bond is a type of covalent bond that plays a critical role in the structure and function of proteins. A peptide bond, also known as an amide bond, forms when the carboxyl group of one amino acid reacts with the amino group of another amino acid, releasing a molecule of water in a condensation reaction. The resulting bond \( -CO-NH- \) links the two amino acids together, allowing the formation of dipeptides, tripeptides, and eventually, long polypeptide chains that fold into proteins.

Understanding the peptide bond is essential as it determines the primary structure of proteins—the unique sequence of amino acids in the polypeptide chain. The stability of a peptide bond is due to the partial double bond character that arises from resonance, which restricts rotation and gives proteins their rigid structure at the bond location.

Through the process of translation, cells reproduce this peptide bonding continually, enabling the synthesis of proteins necessary for life's many functions.
Amino Acids Structure
Amino acids are the building blocks of proteins and play a fundamental role in nearly all biological processes. Each amino acid consists of a central \( \alpha \) carbon atom bonded to four different groups: an amino group (\( -NH_2 \)), a carboxyl group (\( -COOH \)), a hydrogen atom, and a distinctive side chain, often referred to as the \( R \) group.

The structure of an amino acid determines its properties and its role in peptides and proteins. Amino acids like arginine and serine differ in their side chains, with arginine having a complex side chain with multiple nitrogen atoms, making it positively charged at physiological pH, while serine has a hydroxymethyl group that is polar but neutral.

When two amino acids join to form a dipeptide, it is the \( R \) groups that distinguish one dipeptide from another. These side chains impart unique characteristics, such as hydrophobicity or hydrophilicity, which influence the protein's final 3D structure and its interaction with other molecules.
Condensation Reaction
A condensation reaction is a chemical process where two molecules combine to form one larger molecule, with the simultaneous release of a smaller molecule, usually water. In the context of peptides and proteins, the condensation reaction involves the amino group of one amino acid and the carboxyl group of another. This reaction leads to the loss of a water molecule \( (H_2O) \) and the formation of a peptide bond.

The reaction is termed 'condensation' because water is condensed out, or separated from the larger molecule. It is also referred to as a dehydration synthesis because it involves the synthesis of a new bond while abstracting water. This is a type of reaction essential for the biosynthesis of many significant biological macromolecules, including proteins, polysaccharides, and nucleic acids.

In the formation of dipeptides, the condensation reaction is highly specific, with the enzyme peptidyl transferase facilitating bond formation during protein synthesis in cells. This specificity ensures that amino acids are joined together in the exact sequence as dictated by the genetic code.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.

Sign-up for free