Chapter 12: Problem 23
The correct IUPAC name of the compoand
Short Answer
Expert verified
The correct IUPAC name of the compound is (c) 4-carboxy-1-formylcyclohexanone.
Step by step solution
01
Identify the Basic Structure
First, interpret the SMILES (Simplified Molecular Input Line Entry System) notation to determine the basic structure of the compound. The cyclic compound contains a six-membered ring with the additional functional groups attached to it.
02
Determine the Functional Groups
Identify the functional groups within the molecule. The compound contains a carboxylic acid group (-COOH), an aldehyde group (-CHO), and a ketone group (-C=O).
03
Numbering the Ring
The most senior functional group is the carboxylic acid, so numbering starts from the carbon of this group to give the lowest possible numbers to the other functional groups in the ring.
04
Assigning Priority
Following IUPAC nomenclature rules, the carboxylic acid group has higher priority for numbering over aldehyde and ketone. Therefore, it is numbered as '1'.
05
Locating the Other Functional Groups
The aldehyde is on the carbon adjacent to the carboxylic acid and should be numbered as '2', while the ketone is opposite to it, being numbered as '6' in the ring.
06
Naming the Compound
Using IUPAC rules, the full name is constructed with locants for substituents followed by the base name of the cyclic alkane. Here, we have '1-carboxy-' for the carboxylic acid, '2-formyl-' for the aldehyde and '6-oxo-' for the ketone, all on a cyclohexane ring. The 'e' in cyclohexane is replaced by 'one' because of the ketone. Hence, the correct IUPAC name is 2-formyl-1-carboxycyclohexan-6-one.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with Vaia!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
SMILES Notation
The Simplified Molecular Input Line Entry System (SMILES) notation is a way of describing the structure of a chemical species using short ASCII strings. It encodes molecular structures based on the sequence of atoms, branching, and ring closure, while also indicating stereochemistry when necessary.
Using SMILES, you can quickly convey complex structures in a line of text, which is both human-readable and computer-friendly. For instance, the SMILES stringO=C(O)C1CCC(CO)CC1=O represents a cyclic molecule with several functional groups. Decoding this involves visualizing the six-membered ring denoted by 'C1...CC1' and recognizing that '=O' groups are indicative of either ketones or aldehydes, and '(O)' suggests the presence of a carboxylic acid.
Understanding SMILES is a crucial skill in computational chemistry and can significantly help with ideation and communication in the digital age of chemistry.
Using SMILES, you can quickly convey complex structures in a line of text, which is both human-readable and computer-friendly. For instance, the SMILES string
Understanding SMILES is a crucial skill in computational chemistry and can significantly help with ideation and communication in the digital age of chemistry.
Functional Groups in Organic Chemistry
Functional groups are specific groups of atoms within molecules that are responsible for the characteristic chemical reactions of those molecules. Knowing the common functional groups in organic chemistry, such as hydroxyl (-OH), carboxyl (-COOH), aldehyde (-CHO), and ketone (-C=O), among others, is essential.
Different functional groups impart different properties to the compound and help in determining how a compound reacts with other substances. For example, alcohols contain the hydroxyl group, which makes them polar and capable of forming hydrogen bonds. The presence of a carboxylic acid group, as in the compound from the exercise, makes the molecule acidic and influences its naming in the IUPAC nomenclature system.
Different functional groups impart different properties to the compound and help in determining how a compound reacts with other substances. For example, alcohols contain the hydroxyl group, which makes them polar and capable of forming hydrogen bonds. The presence of a carboxylic acid group, as in the compound from the exercise, makes the molecule acidic and influences its naming in the IUPAC nomenclature system.
Priority Rules in IUPAC Naming
The International Union of Pure and Applied Chemistry (IUPAC) has established priority rules to decide the order in which functional groups are named and their relative importance in a compound.
According to these rules, some functional groups take precedence over others when numbering the carbon chain or ring. For example, carboxylic acids rank highest, followed by esters, acids halides, aldehydes, ketones, and so on. It's these rules that dictate we start numbering from the carboxylic acid in the compound given in the exercise.
When applying these priority rules, the goal is to assign the lowest possible numbers to the highest-ranking functional groups. This ensures that the IUPAC name reflects the molecule's structure unambiguously and in accordance with standard conventions.
According to these rules, some functional groups take precedence over others when numbering the carbon chain or ring. For example, carboxylic acids rank highest, followed by esters, acids halides, aldehydes, ketones, and so on. It's these rules that dictate we start numbering from the carboxylic acid in the compound given in the exercise.
When applying these priority rules, the goal is to assign the lowest possible numbers to the highest-ranking functional groups. This ensures that the IUPAC name reflects the molecule's structure unambiguously and in accordance with standard conventions.
Naming Cyclic Compounds
Cyclic compounds are named by identifying the size of the ring and the nature of the constituents that form the ring. In IUPAC nomenclature, the base name indicates the number of carbons in the ring, which is prefixed with 'cyclo-' to indicate that the carbons form a cycle.
When naming cyclic compounds, substituents are considered, and numbering usually begins at the functional group with the highest priority and proceeds in a direction that gives the lowest numbers to the subsequent substituents. In the case of the exercise, we find functional groups like a carboxylic acid and an aldehyde that are crucial in determining the start point for numbering and the position of other groups.
The correct IUPAC name for the compound in question takes into account both the cyclohexane ring and the positions of the carboxylic acid (1), aldehyde (2), and ketone (6) functional groups, resulting in 2-formyl-1-carboxycyclohexan-6-one.
When naming cyclic compounds, substituents are considered, and numbering usually begins at the functional group with the highest priority and proceeds in a direction that gives the lowest numbers to the subsequent substituents. In the case of the exercise, we find functional groups like a carboxylic acid and an aldehyde that are crucial in determining the start point for numbering and the position of other groups.
The correct IUPAC name for the compound in question takes into account both the cyclohexane ring and the positions of the carboxylic acid (1), aldehyde (2), and ketone (6) functional groups, resulting in 2-formyl-1-carboxycyclohexan-6-one.