The reaction of an \(\alpha\)-diketone with concentrated sodium or potassium hydroxide to give the salt of an \(\alpha\)-hydroxyacid is given the general name benzil-benzilic acid rearrangement. It is illustrated by the conversion of benzil to sodium benzilate and then to benzilic acid. Propose a mechanism for this rearrangement. O=C(O)C(=O)C(=O)c1ccccc1 O=C(O)C(O)(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 Benzil Sodium benzilate Benzilic acid

Short Answer

Expert verified
Question: Propose a reasonable mechanism for the benzil-benzilic acid rearrangement, which involves the transformation of benzil into benzilic acid using a strong base. Answer: The mechanism of the benzil-benzilic acid rearrangement involves the following steps: 1) Enolate formation with the help of a strong base, 2) Tautomerization to form a keto-ketone intermediate, 3) Intramolecular nucleophilic attack to form a cyclic intermediate, 4) Protonation of the cyclic intermediate using a water molecule, and 5) An acidic workup to convert the sodium or potassium salt of the α-hydroxyacid into benzilic acid.

Step by step solution

01

1. Identify the reactants and products in the given reaction

The given reaction involves the conversion of benzil to sodium benzilate and then to benzilic acid. We have the following reactants and products: Reactants: - Benzil: \[\text{(C(O)C(=O))}_2 \text{Ph}_2\] - Strong base (either sodium hydroxide or potassium hydroxide) Products: - Sodium benzilate: \[\text{C(O)(OC(=O)c1ccccc1)}_2 \text{Ph}_2\] - Benzilic acid: \[\text{C(OH)(OC(=O)c1ccccc1)}_2 \text{Ph}_2\]
02

2. Use the strong base to start the mechanism

Take the strong base (in this case sodium or potassium hydroxide) and let the hydroxide ion abstract the alpha hydrogen from benzil. This will result in an enolate intermediate. The mechanism starts as follows: \[\text{OH}^{-} + (C(\text{O})C(=O))_2 \text{Ph}_2 \rightarrow \text{C}\text{(O)}(\text{Ph})\underset{-}{\text{C(O-)}}\text{Ph}\]
03

3. Tautomerize the enolate to form the keto-ketone intermediate

Perform a tautomerization (proton shift) on the enolate intermediate to form the keto-ketone intermediate: \[\text{C}\text{(O)}(\text{Ph})\underset{-}{\text{C(O-)}}\text{Ph} \rightarrow \underset{-}{\text{O}}\text{C}\text{(C(O))}\text{Ph}\text{C(=O)Ph}\]
04

4. Perform an intramolecular nucleophilic attack

Have the negative oxygen on the keto-ketone intermediate perform a nucleophilic attack on the neighboring carbonyl carbon, resulting in a cyclic intermediate with a negative charge on the oxygen atom: \[\underset{-}{\text{O}}\text{C}\text{(C(O))}\text{Ph}\text{C(=O)Ph} \rightarrow \text{O}\text{C}\text{(C(O))}\text{Ph}\underset{-}{\text{C(\text{Ph})O}}\]
05

5. Protonate the cyclic intermediate

Protonate the cyclic intermediate with a water molecule, forming the sodium or potassium salt of the α-hydroxyacid: \[\text{O}\text{C}\text{(C(O))}\text{Ph}\underset{-}{\text{C(\text{Ph})O}} + \text{H}_2\text{O} \rightarrow \text{C(O)(OC(=O)c1ccccc1)}_2 \text{Ph}_2 + \text{OH}^{-}\]
06

6. Convert the salt to benzilic acid

Finally, an acidic workup step will convert the sodium or potassium salt of the α-hydroxyacid (sodium benzilate) into benzilic acid: \[\text{C(O)(OC(=O)c1ccccc1)}_2 \text{Ph}_2 + \text{H}^{+} \rightarrow \text{C(OH)(OC(=O)c1ccccc1)}_2 \text{Ph}_2\] In summary, the mechanism of the benzil-benzilic acid rearrangement involves 1) enolate formation, 2) tautomerization, 3) intramolecular nucleophilic attack, 4) protonation of the cyclic intermediate, and 5) an acidic workup to form the final benzilic acid product.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Enolate Formation
Understanding the benzil-benzilic acid rearrangement begins with the concept of enolate formation. This process is crucial because it sets the stage for the reaction. When a strong base, such as sodium hydroxide (NaOH), is added to benzil, it abstracts a hydrogen atom from the alpha position, creating an enolate ion. An enolate ion is essentially a molecule with a negative charge localized on an oxygen atom, which is stabilized by resonance with the adjacent carbon-carbon double bond.

For students, envision the negative charge on oxygen as a springboard—it's poised and ready for the following steps in the rearrangement. This enolate ion is highly reactive due to its nucleophilic nature: it's looking to bond with a positively charged species.
Tautomerization
Once the enolate ion is formed, the next fundamental step is tautomerization. This is the rearrangement of bonds within the molecule, often involving a hydrogen atom moving from one atom to another. In the context of the benzil-benzilic acid rearrangement, tautomerization involves a proton transfer from one carbonyl oxygen to the negatively charged enolate oxygen.

Think of tautomerization as a molecular dance—atoms briefly shuffling positions to create a more stable structure. This step doesn't just rearrange the molecule; it sets up the conditions needed for the subsequent nucleophilic attack. It's a slight shuffle in the molecule that allows for dramatic transformations to begin.
Nucleophilic Attack
The nucleophilic attack is where the 'action' happens in the benzil to benzilic acid transformation. After tautomerization, our dancing molecule has an oxygen with a negative charge. This oxygen is the nucleophile, ready to form a new bond. In this step, the oxygen nucleophile attacks a carbonyl carbon within the same molecule, resulting in a cyclic structure.

Imagine a nucleophile as a character in a video game seeking to make a connection (bond) with a positive center or, in this case, the partially positive carbon of the carbonyl group. It's this action that provides the enigmatic 'rearrangement' part of this reaction's name, as rings are being formed which did not exist previously.
Organic Reaction Mechanisms
Organic reaction mechanisms are the step-by-step descriptions of the chemical process, explaining how reactants are transformed into products. In our case, the benzil-benzilic acid rearrangement mechanism encompasses the formation of an enolate, tautomerization, intramolecular nucleophilic attack, and then final protonation steps.

To fully comprehend such mechanisms, it’s crucial for students to visualize each stage and understand how electrons move from one atom to another, reshaping the structure of the molecule. Each step involves a delicate balance between the geometry of molecules, the energy of the system, and the interplay of charges. Mastery of these concepts allows students to predict the outcomes of reactions and design new molecules—a key skill in organic chemistry.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Low-molecular-weight dicarboxylic acids normally exhibit two different \(\mathrm{p} K_{\mathrm{a}}\) values. Ionization of the first carboxyl group is easier than the second. This effect diminishes with molecular size, and, for adipic acid and longer chain dicarboxylic acids, the two acid ionization constants differ by about one \(\mathrm{p} K\) unit. $$ \begin{array}{llcc} \hline \begin{array}{l} \text { Dicarboxylic } \end{array} & \text { Structural } & & \\ \hline \text { Oxalic } & \text { Formula } & \mathrm{p} K_{\mathrm{a} 1} & \mathrm{p} K_{\mathrm{a} 2} \\ \text { Malonic } & \mathrm{HOOCCOOH} & 1.23 & 4.19 \\ \text { Succinic } & \mathrm{HOOCCH}{ }_{2} \mathrm{COOH} & 2.83 & 5.69 \\ \text { Glutaric } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{2} \mathrm{COOH} & 4.16 & 5.61 \\ \text { Adipic } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{3} \mathrm{COOH} & 4.31 & 5.41 \\ \hline \end{array} $$ Why do the two \(\mathrm{p} K_{\mathrm{a}}\) values differ more for the shorter chain dicarboxylic acids than for the longer chain dicarboxylic acids?

Using your roadmaps as a guide, show how to convert 4-methyl-1-pentene and carbon dioxide into 5 -methylhexanoic acid. You must use 4 -methyl-1-pentene and carbon dioxide as the source of all carbon atoms in the target molecule. Show all reagents and all molecules synthesized along the way. CC(C)CC=CC(=O)O CC(C)CCCC(=O)O 4-Methyl-1-pentene 5-Methylhexanoic acid

Given here are \({ }^{1} \mathrm{H}-\mathrm{NMR}\) and \({ }^{19} \mathrm{C}-\mathrm{NMR}\) spectral data for nine compounds. Each compound shows strong absorption between 1720 and \(1700 \mathrm{~cm}^{-1}\), and strong, broad absorption over the region \(2500-3300 \mathrm{~cm}^{-1}\). Propose a structural formula for each compound. Refer to Appendices 4,5, and 6 for spectral correlation tables. $$ \begin{aligned} &\text { (a) } \mathrm{C}_{5} \mathrm{H}_{10} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.94(\mathrm{t}, 3 \mathrm{H}) & 180.71 \\ 1.39(\mathrm{~m}, 2 \mathrm{H}) & 33.89 \\ 1.62(\mathrm{~m}, 2 \mathrm{H}) & 26.76 \\ 2.35(\mathrm{t}, 2 \mathrm{H}) & 22.21 \\ 12.0(\mathrm{~s}, 1 \mathrm{H}) & 13.69 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (b) } \mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 1.08(\mathrm{~s}, 9 \mathrm{H}) & 179.29 \\ 2.23(\mathrm{~s}, 2 \mathrm{H}) & 47.82 \\ 12.1(\mathrm{~s}, 1 \mathrm{H}) & 30.62 \\ & 29.57 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (c) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{O}_{4}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.93(\mathrm{t}, 3 \mathrm{H}) & 170.94 \\ 1.80(\mathrm{~m}, 2 \mathrm{H}) & 53.28 \\ 3.10(\mathrm{t}, 1 \mathrm{H}) & 21.90 \\ 12.7(\mathrm{~s}, 2 \mathrm{H}) & 11.81 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (d) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{O}_{4}\\\ &\begin{array}{cr} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 1.29(\mathrm{~s}, 6 \mathrm{H}) & 174.01 \\ 12.8(\mathrm{~s}, 2 \mathrm{H}) & 48.77 \\ & 22.56 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (e) } \mathrm{C}_{4} \mathrm{H}_{6} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 1.91(\mathrm{~d}, 3 \mathrm{H}) & 172.26 \\ 5.86(\mathrm{~d}, 1 \mathrm{H}) & 147.53 \\ 7.10(\mathrm{~m}, 1 \mathrm{H}) & 122.24 \\ 12.4(\mathrm{~s}, 1 \mathrm{H}) & 18.11 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (f) } \mathrm{C}_{3} \mathrm{H}_{4} \mathrm{Cl}_{2} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 2.34(\mathrm{~s}, 3 \mathrm{H}) & 171.82 \\ 11.3(\mathrm{~s}, 1 \mathrm{H}) & 79.36 \\ & 34.02 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (g) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{Cl}_{2} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 1.42(\mathrm{~s}, 6 \mathrm{H}) & 180.15 \\ 6.10(\mathrm{~s}, 1 \mathrm{H}) & 77.78 \\ 12.4(\mathrm{~s}, 1 \mathrm{H}) & 51.88 \\ & 20.71 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (h) } \mathrm{C}_{5} \mathrm{H}_{9} \mathrm{BrO}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.97(\mathrm{t}, 3 \mathrm{H}) & 176.36 \\ 1.50(\mathrm{~m}, 2 \mathrm{H}) & 45.08 \\ 2.05(\mathrm{~m}, 2 \mathrm{H}) & 36.49 \\ 4.25(\mathrm{t}, 1 \mathrm{H}) & 20.48 \\ 12.1(\mathrm{~s}, 1 \mathrm{H}) & 13.24 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (i) } \mathrm{C}_{4} \mathrm{H}_{8} \mathrm{O}_{3}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 2.62(\mathrm{t}, 2 \mathrm{H}) & 177.33 \\ 3.38(\mathrm{~s}, 3 \mathrm{H}) & 67.55 \\ 3.68(\mathrm{~s}, 2 \mathrm{H}) & 58.72 \\ 11.5(\mathrm{~s}, 1 \mathrm{H}) & 34.75 \\ \hline \end{array} \end{aligned} $$

When 4-hydroxybutanoic acid is treated with an acid catalyst, it forms a lactone (a cyclic ester). Draw the structural formula of this lactone, and propose a mechanism for its formation.

Give the expected organic product when phenylacetic acid, PhCH \({ }_{2} \mathrm{COOH}_{\text {, is treated }}\) with each reagent. (a) \(\mathrm{SOCl}_{2}\) (b) \(\mathrm{NaHCO}_{3}, \mathrm{H}_{2} \mathrm{O}\) (c) \(\mathrm{NaOH}, \mathrm{H}_{2} \mathrm{O}\) (d) \(\mathrm{CH}_{3} \mathrm{MgBr}\) (one equivalent) (e) \(\mathrm{LiAlH}_{4}\) followed by \(\mathrm{H}_{2} \mathrm{O}\) (f) \(\mathrm{CH}_{2} \mathrm{~N}_{2}\) (g) \(\mathrm{CH}_{3} \mathrm{OH}+\mathrm{H}_{2} \mathrm{SO}_{4}\) (catalyst)

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.

Sign-up for free